C17H22F2N2 — CID 103587511
3-tert-butyl-5,8-difluoro-6-methyl-N-propylquinolin-2-amine (PubChem CID 103587511) has the molecular formula C17H22F2N2 and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-tert-butyl-5,8-difluoro-6-methyl-N-propylquinolin-2-amine.
| Compound Name | 3-tert-butyl-5,8-difluoro-6-methyl-N-propylquinolin-2-amine |
|---|---|
| PubChem CID | 103587511 |
| Molecular Formula | C17H22F2N2 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-tert-butyl-5,8-difluoro-6-methyl-N-propylquinolin-2-amine |
| SMILES | CCCNc1nc2c(F)cc(C)c(F)c2cc1C(C)(C)C |
| InChI | InChI=1S/C17H22F2N2/c1-6-7-20-16-12(17(3,4)5)9-11-14(19)10(2)8-13(18)15(11)21-16/h8-9H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | VHKGAGQFBIGVEP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |