C13H14F3N3 — CID 63386017
(3-tert-butyl-5,6,8-trifluoroquinolin-2-yl)hydrazine (PubChem CID 63386017) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is (3-tert-butyl-5,6,8-trifluoroquinolin-2-yl)hydrazine.
| Compound Name | (3-tert-butyl-5,6,8-trifluoroquinolin-2-yl)hydrazine |
|---|---|
| PubChem CID | 63386017 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3-tert-butyl-5,6,8-trifluoroquinolin-2-yl)hydrazine |
| SMILES | CC(C)(C)c1cc2c(F)c(F)cc(F)c2nc1NN |
| InChI | InChI=1S/C13H14F3N3/c1-13(2,3)7-4-6-10(16)8(14)5-9(15)11(6)18-12(7)19-17/h4-5H,17H2,1-3H3,(H,18,19) |
| InChIKey | WGAYTASKFCCKSF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|