C14H17Cl2N3 — CID 113445996
(3-tert-butyl-5,8-dichloro-6-methylquinolin-2-yl)hydrazine (PubChem CID 113445996) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is (3-tert-butyl-5,8-dichloro-6-methylquinolin-2-yl)hydrazine.
| Compound Name | (3-tert-butyl-5,8-dichloro-6-methylquinolin-2-yl)hydrazine |
|---|---|
| PubChem CID | 113445996 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (3-tert-butyl-5,8-dichloro-6-methylquinolin-2-yl)hydrazine |
| SMILES | Cc1cc(Cl)c2nc(NN)c(C(C)(C)C)cc2c1Cl |
| InChI | InChI=1S/C14H17Cl2N3/c1-7-5-10(15)12-8(11(7)16)6-9(14(2,3)4)13(18-12)19-17/h5-6H,17H2,1-4H3,(H,18,19) |
| InChIKey | GKIQTTPYESXHCB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|