C12H12Cl3N3 — CID 63553722
(5,6,8-trichloro-2-ethyl-3-methylquinolin-4-yl)hydrazine (PubChem CID 63553722) has the molecular formula C12H12Cl3N3 and a molecular weight of 304.61 g/mol. Its IUPAC name is (5,6,8-trichloro-2-ethyl-3-methylquinolin-4-yl)hydrazine.
| Compound Name | (5,6,8-trichloro-2-ethyl-3-methylquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 63553722 |
| Molecular Formula | C12H12Cl3N3 |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (5,6,8-trichloro-2-ethyl-3-methylquinolin-4-yl)hydrazine |
| SMILES | CCc1nc2c(Cl)cc(Cl)c(Cl)c2c(NN)c1C |
| InChI | InChI=1S/C12H12Cl3N3/c1-3-8-5(2)11(18-16)9-10(15)6(13)4-7(14)12(9)17-8/h4H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | FXUNQIDVNVDYOZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|