C15H19ClN2 — CID 63560531
8-chloro-2-ethyl-3-methyl-N-propylquinolin-4-amine (PubChem CID 63560531) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 8-chloro-2-ethyl-3-methyl-N-propylquinolin-4-amine.
| Compound Name | 8-chloro-2-ethyl-3-methyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63560531 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 8-chloro-2-ethyl-3-methyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C)c(CC)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C15H19ClN2/c1-4-9-17-14-10(3)13(5-2)18-15-11(14)7-6-8-12(15)16/h6-8H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | MJMSYVSMVZFVHJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |