C10H8Cl2N2 — CID 105484309
2,8-dichloro-4-ethylquinazoline (PubChem CID 105484309) has the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. Its IUPAC name is 2,8-dichloro-4-ethylquinazoline.
| Compound Name | 2,8-dichloro-4-ethylquinazoline |
|---|---|
| PubChem CID | 105484309 |
| Molecular Formula | C10H8Cl2N2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2,8-dichloro-4-ethylquinazoline |
| SMILES | CCc1nc(Cl)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C10H8Cl2N2/c1-2-8-6-4-3-5-7(11)9(6)14-10(12)13-8/h3-5H,2H2,1H3 |
| InChIKey | WKDQVOAHXFMNHA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |