C12H11ClF2N2 — CID 62890710
8-chloro-2-(difluoromethyl)-N-ethylquinolin-4-amine (PubChem CID 62890710) has the molecular formula C12H11ClF2N2 and a molecular weight of 256.68 g/mol. Its IUPAC name is 8-chloro-2-(difluoromethyl)-N-ethylquinolin-4-amine.
| Compound Name | 8-chloro-2-(difluoromethyl)-N-ethylquinolin-4-amine |
|---|---|
| PubChem CID | 62890710 |
| Molecular Formula | C12H11ClF2N2 |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 8-chloro-2-(difluoromethyl)-N-ethylquinolin-4-amine |
| SMILES | CCNc1cc(C(F)F)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C12H11ClF2N2/c1-2-16-9-6-10(12(14)15)17-11-7(9)4-3-5-8(11)13/h3-6,12H,2H2,1H3,(H,16,17) |
| InChIKey | GFDSGSWRMPXYAW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |