C13H13BrF2N2 — CID 62891074
5-bromo-2-(difluoromethyl)-N-ethyl-8-methylquinolin-4-amine (PubChem CID 62891074) has the molecular formula C13H13BrF2N2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 5-bromo-2-(difluoromethyl)-N-ethyl-8-methylquinolin-4-amine.
| Compound Name | 5-bromo-2-(difluoromethyl)-N-ethyl-8-methylquinolin-4-amine |
|---|---|
| PubChem CID | 62891074 |
| Molecular Formula | C13H13BrF2N2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5-bromo-2-(difluoromethyl)-N-ethyl-8-methylquinolin-4-amine |
| SMILES | CCNc1cc(C(F)F)nc2c(C)ccc(Br)c12 |
| InChI | InChI=1S/C13H13BrF2N2/c1-3-17-9-6-10(13(15)16)18-12-7(2)4-5-8(14)11(9)12/h4-6,13H,3H2,1-2H3,(H,17,18) |
| InChIKey | YVZQLDKBKRJUNY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |