C14H14BrF3N2 — CID 63479785
5-bromo-8-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 63479785) has the molecular formula C14H14BrF3N2 and a molecular weight of 347.18 g/mol. Its IUPAC name is 5-bromo-8-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 5-bromo-8-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 63479785 |
| Molecular Formula | C14H14BrF3N2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 5-bromo-8-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CCCNc1cc(C(F)(F)F)nc2c(C)ccc(Br)c12 |
| InChI | InChI=1S/C14H14BrF3N2/c1-3-6-19-10-7-11(14(16,17)18)20-13-8(2)4-5-9(15)12(10)13/h4-5,7H,3,6H2,1-2H3,(H,19,20) |
| InChIKey | INUPQCZVCQPEKR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |