C15H20N2 — CID 63480948
2,5,8-trimethyl-N-propylquinolin-4-amine (PubChem CID 63480948) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,5,8-trimethyl-N-propylquinolin-4-amine.
| Compound Name | 2,5,8-trimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63480948 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,5,8-trimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1cc(C)nc2c(C)ccc(C)c12 |
| InChI | InChI=1S/C15H20N2/c1-5-8-16-13-9-12(4)17-15-11(3)7-6-10(2)14(13)15/h6-7,9H,5,8H2,1-4H3,(H,16,17) |
| InChIKey | WSJXWOOPOUXLSZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |