C13H12F3IN2 — CID 55194221
8-iodo-N-propyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 55194221) has the molecular formula C13H12F3IN2 and a molecular weight of 380.15 g/mol. Its IUPAC name is 8-iodo-N-propyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 8-iodo-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 55194221 |
| Molecular Formula | C13H12F3IN2 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 8-iodo-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CCCNc1cc(C(F)(F)F)nc2c(I)cccc12 |
| InChI | InChI=1S/C13H12F3IN2/c1-2-6-18-10-7-11(13(14,15)16)19-12-8(10)4-3-5-9(12)17/h3-5,7H,2,6H2,1H3,(H,18,19) |
| InChIKey | JFNFCXNVIYKEGD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|