C11H11F3N2S — CID 66354977
N-propyl-5-(trifluoromethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 66354977) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is N-propyl-5-(trifluoromethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | N-propyl-5-(trifluoromethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 66354977 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-propyl-5-(trifluoromethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | CCCNc1cc(C(F)(F)F)nc2ccsc12 |
| InChI | InChI=1S/C11H11F3N2S/c1-2-4-15-8-6-9(11(12,13)14)16-7-3-5-17-10(7)8/h3,5-6H,2,4H2,1H3,(H,15,16) |
| InChIKey | GOXRAUSJBNHNFX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |