C13H14F3N3S — CID 114563363
4-(5-methylthiophen-3-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114563363) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-(5-methylthiophen-3-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(5-methylthiophen-3-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114563363 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-(5-methylthiophen-3-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCNc1nc(-c2csc(C)c2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H14F3N3S/c1-3-4-17-12-18-10(9-5-8(2)20-7-9)6-11(19-12)13(14,15)16/h5-7H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | OVSFXEWREKRWEX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |