C13H16N2S — CID 102824819
2-(5-methylthiophen-3-yl)-N-propylpyridin-4-amine (PubChem CID 102824819) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-(5-methylthiophen-3-yl)-N-propylpyridin-4-amine.
| Compound Name | 2-(5-methylthiophen-3-yl)-N-propylpyridin-4-amine |
|---|---|
| PubChem CID | 102824819 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(5-methylthiophen-3-yl)-N-propylpyridin-4-amine |
| SMILES | CCCNc1ccnc(-c2csc(C)c2)c1 |
| InChI | InChI=1S/C13H16N2S/c1-3-5-14-12-4-6-15-13(8-12)11-7-10(2)16-9-11/h4,6-9H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | XQUIGALUUVRSQN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |