C14H20N4O6P2 — CID 58175914
2-[[2-[4-(2-phosphonoethylamino)-2-pyridinyl]-4-pyridinyl]amino]ethylphosphonic acid (PubChem CID 58175914) has the molecular formula C14H20N4O6P2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 2-[[2-[4-(2-phosphonoethylamino)-2-pyridinyl]-4-pyridinyl]amino]ethylphosphonic acid.
| Compound Name | 2-[[2-[4-(2-phosphonoethylamino)-2-pyridinyl]-4-pyridinyl]amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 58175914 |
| Molecular Formula | C14H20N4O6P2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[[2-[4-(2-phosphonoethylamino)-2-pyridinyl]-4-pyridinyl]amino]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCNc1ccnc(-c2cc(NCCP(=O)(O)O)ccn2)c1 |
| InChI | InChI=1S/C14H20N4O6P2/c19-25(20,21)7-5-15-11-1-3-17-13(9-11)14-10-12(2-4-18-14)16-6-8-26(22,23)24/h1-4,9-10H,5-8H2,(H,15,17)(H,16,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | DNFWUWFMHKVBSC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|