C11H11ClF3N5 — CID 114566071
4-(4-chloropyrazol-1-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566071) has the molecular formula C11H11ClF3N5 and a molecular weight of 305.69 g/mol. Its IUPAC name is 4-(4-chloropyrazol-1-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(4-chloropyrazol-1-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566071 |
| Molecular Formula | C11H11ClF3N5 |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-(4-chloropyrazol-1-yl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCNc1nc(-n2cc(Cl)cn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H11ClF3N5/c1-2-3-16-10-18-8(11(13,14)15)4-9(19-10)20-6-7(12)5-17-20/h4-6H,2-3H2,1H3,(H,16,18,19) |
| InChIKey | HBRRDVYFNTVWGK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |