C11H12ClN7 — CID 114786663
6-(4-chloropyrazol-1-yl)-N-propyl-7H-purin-2-amine (PubChem CID 114786663) has the molecular formula C11H12ClN7 and a molecular weight of 277.72 g/mol. Its IUPAC name is 6-(4-chloropyrazol-1-yl)-N-propyl-7H-purin-2-amine.
| Compound Name | 6-(4-chloropyrazol-1-yl)-N-propyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114786663 |
| Molecular Formula | C11H12ClN7 |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 6-(4-chloropyrazol-1-yl)-N-propyl-7H-purin-2-amine |
| SMILES | CCCNc1nc(-n2cc(Cl)cn2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H12ClN7/c1-2-3-13-11-17-9-8(14-6-15-9)10(18-11)19-5-7(12)4-16-19/h4-6H,2-3H2,1H3,(H2,13,14,15,17,18) |
| InChIKey | MTZAOXVOTIQYPD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |