C8H10ClN5 — CID 22149709
2-chloro-N-propyl-7H-purin-6-amine (PubChem CID 22149709) has the molecular formula C8H10ClN5 and a molecular weight of 211.66 g/mol. Its IUPAC name is 2-chloro-N-propyl-7H-purin-6-amine.
| Compound Name | 2-chloro-N-propyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 22149709 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-chloro-N-propyl-7H-purin-6-amine |
| SMILES | CCCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C8H10ClN5/c1-2-3-10-6-5-7(12-4-11-5)14-8(9)13-6/h4H,2-3H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | XSKMMLUIHYEGMP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |