C13H11ClFN5 — CID 104697462
2-chloro-N-[2-(4-fluorophenyl)ethyl]-7H-purin-6-amine (PubChem CID 104697462) has the molecular formula C13H11ClFN5 and a molecular weight of 291.72 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-fluorophenyl)ethyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[2-(4-fluorophenyl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 104697462 |
| Molecular Formula | C13H11ClFN5 |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-chloro-N-[2-(4-fluorophenyl)ethyl]-7H-purin-6-amine |
| SMILES | Fc1ccc(CCNc2nc(Cl)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C13H11ClFN5/c14-13-19-11(10-12(20-13)18-7-17-10)16-6-5-8-1-3-9(15)4-2-8/h1-4,7H,5-6H2,(H2,16,17,18,19,20) |
| InChIKey | HOQDTBLILWJXAG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |