C13H10Cl3N5 — CID 104697470
2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-7H-purin-6-amine (PubChem CID 104697470) has the molecular formula C13H10Cl3N5 and a molecular weight of 342.62 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 104697470 |
| Molecular Formula | C13H10Cl3N5 |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-7H-purin-6-amine |
| SMILES | Clc1ccc(CCNc2nc(Cl)nc3nc[nH]c23)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3N5/c14-8-2-1-7(9(15)5-8)3-4-17-11-10-12(19-6-18-10)21-13(16)20-11/h1-2,5-6H,3-4H2,(H2,17,18,19,20,21) |
| InChIKey | SRLBKINAOMWMGN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |