C12H18ClN5O — CID 113481188
N-(3-butoxypropyl)-2-chloro-7H-purin-6-amine (PubChem CID 113481188) has the molecular formula C12H18ClN5O and a molecular weight of 283.76 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-chloro-7H-purin-6-amine.
| Compound Name | N-(3-butoxypropyl)-2-chloro-7H-purin-6-amine |
|---|---|
| PubChem CID | 113481188 |
| Molecular Formula | C12H18ClN5O |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(3-butoxypropyl)-2-chloro-7H-purin-6-amine |
| SMILES | CCCCOCCCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H18ClN5O/c1-2-3-6-19-7-4-5-14-10-9-11(16-8-15-9)18-12(13)17-10/h8H,2-7H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | DAPNSXFNZUMNEV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|