C9H14N6O — CID 115669328
6-N-(3-methoxypropyl)-7H-purine-2,6-diamine (PubChem CID 115669328) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-N-(3-methoxypropyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(3-methoxypropyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 115669328 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 6-N-(3-methoxypropyl)-7H-purine-2,6-diamine |
| SMILES | COCCCNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H14N6O/c1-16-4-2-3-11-7-6-8(13-5-12-6)15-9(10)14-7/h5H,2-4H2,1H3,(H4,10,11,12,13,14,15) |
| InChIKey | GJTIHTGTRABDPA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|