C8H11N7O — CID 114783932
3-[(2-amino-7H-purin-6-yl)amino]propanamide (PubChem CID 114783932) has the molecular formula C8H11N7O and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)amino]propanamide.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)amino]propanamide |
|---|---|
| PubChem CID | 114783932 |
| Molecular Formula | C8H11N7O |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)amino]propanamide |
| SMILES | NC(=O)CCNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C8H11N7O/c9-4(16)1-2-11-6-5-7(13-3-12-5)15-8(10)14-6/h3H,1-2H2,(H2,9,16)(H4,10,11,12,13,14,15) |
| InChIKey | VZDVGHYFFMDWOY-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |