C10H14N6S — CID 104623515
6-N-(2-prop-2-enylsulfanylethyl)-7H-purine-2,6-diamine (PubChem CID 104623515) has the molecular formula C10H14N6S and a molecular weight of 250.33 g/mol. Its IUPAC name is 6-N-(2-prop-2-enylsulfanylethyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2-prop-2-enylsulfanylethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 104623515 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 6-N-(2-prop-2-enylsulfanylethyl)-7H-purine-2,6-diamine |
| SMILES | C=CCSCCNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H14N6S/c1-2-4-17-5-3-12-8-7-9(14-6-13-7)16-10(11)15-8/h2,6H,1,3-5H2,(H4,11,12,13,14,15,16) |
| InChIKey | WBOZJEDSNRJBRB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|