C7H9N7O — CID 114783660
2-[(2-amino-7H-purin-6-yl)amino]acetamide (PubChem CID 114783660) has the molecular formula C7H9N7O and a molecular weight of 207.20 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)amino]acetamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 114783660 |
| Molecular Formula | C7H9N7O |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)amino]acetamide |
| SMILES | NC(=O)CNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C7H9N7O/c8-3(15)1-10-5-4-6(12-2-11-4)14-7(9)13-5/h2H,1H2,(H2,8,15)(H4,9,10,11,12,13,14) |
| InChIKey | DXVYCHNZCJPIRF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |