C5H5FN6 — CID 143836083
6-N-fluoro-7H-purine-2,6-diamine (PubChem CID 143836083) has the molecular formula C5H5FN6 and a molecular weight of 168.14 g/mol. Its IUPAC name is 6-N-fluoro-7H-purine-2,6-diamine.
| Compound Name | 6-N-fluoro-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 143836083 |
| Molecular Formula | C5H5FN6 |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 6-N-fluoro-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NF)c2[nH]cnc2n1 |
| InChI | InChI=1S/C5H5FN6/c6-12-4-2-3(9-1-8-2)10-5(7)11-4/h1H,(H4,7,8,9,10,11,12) |
| InChIKey | KSWPVGAOKKAXRQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|