C10H14N6 — CID 115669383
6-N-(cyclobutylmethyl)-7H-purine-2,6-diamine (PubChem CID 115669383) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-N-(cyclobutylmethyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(cyclobutylmethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 115669383 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-N-(cyclobutylmethyl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NCC2CCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H14N6/c11-10-15-8(12-4-6-2-1-3-6)7-9(16-10)14-5-13-7/h5-6H,1-4H2,(H4,11,12,13,14,15,16) |
| InChIKey | ZCELABVAAYOACQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |