C8H12N6 — CID 22916641
6-N-propyl-7H-purine-2,6-diamine (PubChem CID 22916641) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 6-N-propyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-propyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 22916641 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 6-N-propyl-7H-purine-2,6-diamine |
| SMILES | CCCNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C8H12N6/c1-2-3-10-6-5-7(12-4-11-5)14-8(9)13-6/h4H,2-3H2,1H3,(H4,9,10,11,12,13,14) |
| InChIKey | AOXHQKGOOSWBRT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |