C11H18N6 — CID 114783634
2-N,6-N-dipropyl-7H-purine-2,6-diamine (PubChem CID 114783634) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is 2-N,6-N-dipropyl-7H-purine-2,6-diamine.
| Compound Name | 2-N,6-N-dipropyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783634 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-N,6-N-dipropyl-7H-purine-2,6-diamine |
| SMILES | CCCNc1nc(NCCC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H18N6/c1-3-5-12-9-8-10(15-7-14-8)17-11(16-9)13-6-4-2/h7H,3-6H2,1-2H3,(H3,12,13,14,15,16,17) |
| InChIKey | UZFRCLFWMNGZTQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |