C12H20N6O2 — CID 114785802
2-methyl-2-[[2-(propylamino)-7H-purin-6-yl]amino]propane-1,3-diol (PubChem CID 114785802) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-methyl-2-[[2-(propylamino)-7H-purin-6-yl]amino]propane-1,3-diol.
| Compound Name | 2-methyl-2-[[2-(propylamino)-7H-purin-6-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 114785802 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-methyl-2-[[2-(propylamino)-7H-purin-6-yl]amino]propane-1,3-diol |
| SMILES | CCCNc1nc(NC(C)(CO)CO)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H20N6O2/c1-3-4-13-11-16-9-8(14-7-15-9)10(17-11)18-12(2,5-19)6-20/h7,19-20H,3-6H2,1-2H3,(H3,13,14,15,16,17,18) |
| InChIKey | YGZVLNUVOCLBSZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |