C11H17N7O2 — CID 106179008
2-hydroxy-3-[[2-(propylamino)-7H-purin-6-yl]amino]propanamide (PubChem CID 106179008) has the molecular formula C11H17N7O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-(propylamino)-7H-purin-6-yl]amino]propanamide.
| Compound Name | 2-hydroxy-3-[[2-(propylamino)-7H-purin-6-yl]amino]propanamide |
|---|---|
| PubChem CID | 106179008 |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-hydroxy-3-[[2-(propylamino)-7H-purin-6-yl]amino]propanamide |
| SMILES | CCCNc1nc(NCC(O)C(N)=O)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H17N7O2/c1-2-3-13-11-17-9(14-4-6(19)8(12)20)7-10(18-11)16-5-15-7/h5-6,19H,2-4H2,1H3,(H2,12,20)(H3,13,14,15,16,17,18) |
| InChIKey | CAJZAZHIXAZATB-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |