C12H20N6O — CID 114785002
2-ethyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]butan-1-ol (PubChem CID 114785002) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-ethyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]butan-1-ol.
| Compound Name | 2-ethyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 114785002 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-ethyl-2-[[2-(methylamino)-7H-purin-6-yl]amino]butan-1-ol |
| SMILES | CCC(CC)(CO)Nc1nc(NC)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H20N6O/c1-4-12(5-2,6-19)18-10-8-9(15-7-14-8)16-11(13-3)17-10/h7,19H,4-6H2,1-3H3,(H3,13,14,15,16,17,18) |
| InChIKey | TYYAZCSIMCNTPA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |