C9H11F3N6 — CID 114783696
2-N-ethyl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine (PubChem CID 114783696) has the molecular formula C9H11F3N6 and a molecular weight of 260.22 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783696 |
| Molecular Formula | C9H11F3N6 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-N-ethyl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NCC(F)(F)F)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H11F3N6/c1-2-13-8-17-6(14-3-9(10,11)12)5-7(18-8)16-4-15-5/h4H,2-3H2,1H3,(H3,13,14,15,16,17,18) |
| InChIKey | BGPDGMGMMJAGGU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |