C10H16N6O2S — CID 114784046
2-N-ethyl-6-N-(2-methylsulfonylethyl)-7H-purine-2,6-diamine (PubChem CID 114784046) has the molecular formula C10H16N6O2S and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(2-methylsulfonylethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(2-methylsulfonylethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114784046 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-N-ethyl-6-N-(2-methylsulfonylethyl)-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NCCS(C)(=O)=O)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H16N6O2S/c1-3-11-10-15-8(12-4-5-19(2,17)18)7-9(16-10)14-6-13-7/h6H,3-5H2,1-2H3,(H3,11,12,13,14,15,16) |
| InChIKey | ZVADQMXTJWUCRY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |