C16H20N6O — CID 117085395
2-N-ethyl-6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine (PubChem CID 117085395) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-N-ethyl-6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117085395 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-N-ethyl-6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NCCc2ccc(OC)cc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H20N6O/c1-3-17-16-21-14(13-15(22-16)20-10-19-13)18-9-8-11-4-6-12(23-2)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H3,17,18,19,20,21,22) |
| InChIKey | ILQINUKDBVZSLN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |