C14H16N6O — CID 39377702
6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine (PubChem CID 39377702) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 39377702 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-N-[2-(4-methoxyphenyl)ethyl]-7H-purine-2,6-diamine |
| SMILES | COc1ccc(CCNc2nc(N)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C14H16N6O/c1-21-10-4-2-9(3-5-10)6-7-16-12-11-13(18-8-17-11)20-14(15)19-12/h2-5,8H,6-7H2,1H3,(H4,15,16,17,18,19,20) |
| InChIKey | CFRHMFVVVITVBP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |