C24H24N6O2 — CID 117081710
N-cyclopropyl-4-[6-[2-(4-methoxyphenyl)ethylamino]-7H-purin-2-yl]benzamide (PubChem CID 117081710) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-[2-(4-methoxyphenyl)ethylamino]-7H-purin-2-yl]benzamide.
| Compound Name | N-cyclopropyl-4-[6-[2-(4-methoxyphenyl)ethylamino]-7H-purin-2-yl]benzamide |
|---|---|
| PubChem CID | 117081710 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-cyclopropyl-4-[6-[2-(4-methoxyphenyl)ethylamino]-7H-purin-2-yl]benzamide |
| SMILES | COc1ccc(CCNc2nc(-c3ccc(C(=O)NC4CC4)cc3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C24H24N6O2/c1-32-19-10-2-15(3-11-19)12-13-25-22-20-23(27-14-26-20)30-21(29-22)16-4-6-17(7-5-16)24(31)28-18-8-9-18/h2-7,10-11,14,18H,8-9,12-13H2,1H3,(H,28,31)(H2,25,26,27,29,30) |
| InChIKey | RZYUSBFHMGWIOE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |