C15H18N6O3 — CID 86271803
6-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-purine-2,6-diamine (PubChem CID 86271803) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 6-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 86271803 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 6-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-purine-2,6-diamine |
| SMILES | COc1cc(CNc2nc(N)nc3nc[nH]c23)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N6O3/c1-22-9-4-8(5-10(23-2)12(9)24-3)6-17-13-11-14(19-7-18-11)21-15(16)20-13/h4-5,7H,6H2,1-3H3,(H4,16,17,18,19,20,21) |
| InChIKey | QAMCQHFQCXHKIV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |