C10H12N8 — CID 113434107
6-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-7H-purine-2,6-diamine (PubChem CID 113434107) has the molecular formula C10H12N8 and a molecular weight of 244.26 g/mol. Its IUPAC name is 6-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 113434107 |
| Molecular Formula | C10H12N8 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 6-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-7H-purine-2,6-diamine |
| SMILES | Cc1[nH]ncc1CNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H12N8/c1-5-6(3-15-18-5)2-12-8-7-9(14-4-13-7)17-10(11)16-8/h3-4H,2H2,1H3,(H,15,18)(H4,11,12,13,14,16,17) |
| InChIKey | LEKGKQZGWXKRTO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |