C9H12N6O — CID 136974356
5-amino-4-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136974356) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is 5-amino-4-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974356 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 5-amino-4-[(5-methyl-1H-pyrazol-4-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1[nH]ncc1CNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H12N6O/c1-5-6(3-14-15-5)2-11-8-7(10)9(16)13-4-12-8/h3-4H,2,10H2,1H3,(H,14,15)(H2,11,12,13,16) |
| InChIKey | FFBHSKLVPBQQJT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |