C12H17N5O2 — CID 136975236
5-methoxy-4-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-1H-pyrimidin-6-one (PubChem CID 136975236) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-methoxy-4-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975236 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-methoxy-4-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-1H-pyrimidin-6-one |
| SMILES | COc1c(NCCCc2cn[nH]c2C)nc[nH]c1=O |
| InChI | InChI=1S/C12H17N5O2/c1-8-9(6-16-17-8)4-3-5-13-11-10(19-2)12(18)15-7-14-11/h6-7H,3-5H2,1-2H3,(H,16,17)(H2,13,14,15,18) |
| InChIKey | KKMDLVYTPQJCOM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|