C13H22N4O4 — CID 136977510
tert-butyl N-[3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]propyl]carbamate (PubChem CID 136977510) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 136977510 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | tert-butyl N-[3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]propyl]carbamate |
| SMILES | COc1c(NCCCNC(=O)OC(C)(C)C)nc[nH]c1=O |
| InChI | InChI=1S/C13H22N4O4/c1-13(2,3)21-12(19)15-7-5-6-14-10-9(20-4)11(18)17-8-16-10/h8H,5-7H2,1-4H3,(H,15,19)(H2,14,16,17,18) |
| InChIKey | AKAQCOVHZMZMAD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|