C13H22N4O3 — CID 115657447
tert-butyl N-[3-[(4-methyl-3-oxopyrazin-2-yl)amino]propyl]carbamate (PubChem CID 115657447) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-methyl-3-oxopyrazin-2-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-methyl-3-oxopyrazin-2-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 115657447 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | tert-butyl N-[3-[(4-methyl-3-oxopyrazin-2-yl)amino]propyl]carbamate |
| SMILES | Cn1ccnc(NCCCNC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C13H22N4O3/c1-13(2,3)20-12(19)16-7-5-6-14-10-11(18)17(4)9-8-15-10/h8-9H,5-7H2,1-4H3,(H,14,15)(H,16,19) |
| InChIKey | MUMDUOIOEYNBHY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|