C11H19N3O5S — CID 164578125
1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]imidazole-2-sulfonic acid (PubChem CID 164578125) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]imidazole-2-sulfonic acid.
| Compound Name | 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]imidazole-2-sulfonic acid |
|---|---|
| PubChem CID | 164578125 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]imidazole-2-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1ccnc1S(=O)(=O)O |
| InChI | InChI=1S/C11H19N3O5S/c1-11(2,3)19-10(15)13-5-4-7-14-8-6-12-9(14)20(16,17)18/h6,8H,4-5,7H2,1-3H3,(H,13,15)(H,16,17,18) |
| InChIKey | NFFFETBDEVBMPZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|