C17H30N4O3 — CID 56794243
tert-butyl N-[2-methyl-4-[3-(2-methylimidazol-1-yl)propylamino]-4-oxobutan-2-yl]carbamate (PubChem CID 56794243) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-4-[3-(2-methylimidazol-1-yl)propylamino]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-4-[3-(2-methylimidazol-1-yl)propylamino]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56794243 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | tert-butyl N-[2-methyl-4-[3-(2-methylimidazol-1-yl)propylamino]-4-oxobutan-2-yl]carbamate |
| SMILES | Cc1nccn1CCCNC(=O)CC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N4O3/c1-13-18-9-11-21(13)10-7-8-19-14(22)12-17(5,6)20-15(23)24-16(2,3)4/h9,11H,7-8,10,12H2,1-6H3,(H,19,22)(H,20,23) |
| InChIKey | JHFYFGGOKYYEDE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|