C15H22N4O2 — CID 23562613
tert-butyl N-(4-imidazo[4,5-b]pyridin-3-ylbutyl)carbamate (PubChem CID 23562613) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is tert-butyl N-(4-imidazo[4,5-b]pyridin-3-ylbutyl)carbamate.
| Compound Name | tert-butyl N-(4-imidazo[4,5-b]pyridin-3-ylbutyl)carbamate |
|---|---|
| PubChem CID | 23562613 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl N-(4-imidazo[4,5-b]pyridin-3-ylbutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCn1cnc2cccnc21 |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,3)21-14(20)17-8-4-5-10-19-11-18-12-7-6-9-16-13(12)19/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,17,20) |
| InChIKey | HSOMNYWPPPLSLU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|