C24H30N4O2P+ — CID 159133812
4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tripyridin-2-ylphosphanium (PubChem CID 159133812) has the molecular formula C24H30N4O2P+ and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tripyridin-2-ylphosphanium.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tripyridin-2-ylphosphanium |
|---|---|
| PubChem CID | 159133812 |
| Molecular Formula | C24H30N4O2P+ |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tripyridin-2-ylphosphanium |
| SMILES | CC(C)(C)OC(=O)NCCCC[P+](c1ccccn1)(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C24H29N4O2P/c1-24(2,3)30-23(29)28-18-10-11-19-31(20-12-4-7-15-25-20,21-13-5-8-16-26-21)22-14-6-9-17-27-22/h4-9,12-17H,10-11,18-19H2,1-3H3/p+1 |
| InChIKey | KHFNYCGALGTCDH-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|