C18H26N4O2S — CID 54277213
tert-butyl N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]carbamate (PubChem CID 54277213) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 54277213 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | tert-butyl N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C18H26N4O2S/c1-18(2,3)24-17(23)21-12-7-4-6-11-20-16-22-15(13-25-16)14-9-5-8-10-19-14/h5,8-10,13H,4,6-7,11-12H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | ROFVEQHAKQWIFH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|