C15H18N4O2 — CID 66523268
tert-butyl N-[(4-pyridin-2-ylpyrimidin-2-yl)methyl]carbamate (PubChem CID 66523268) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is tert-butyl N-[(4-pyridin-2-ylpyrimidin-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-pyridin-2-ylpyrimidin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 66523268 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | tert-butyl N-[(4-pyridin-2-ylpyrimidin-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C15H18N4O2/c1-15(2,3)21-14(20)18-10-13-17-9-7-12(19-13)11-6-4-5-8-16-11/h4-9H,10H2,1-3H3,(H,18,20) |
| InChIKey | XNIBGHBUDRMMNB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |