C19H26N4O4 — CID 176549664
5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate (PubChem CID 176549664) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 176549664 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCCCCOC(=O)c1cc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C19H26N4O4/c1-19(2,3)27-18(25)21-11-6-4-8-12-26-17(24)16-13-15(22-23-16)14-9-5-7-10-20-14/h5,7,9-10,13H,4,6,8,11-12H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | PZCJSENTKUXDRH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|